About 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile
2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile (PubChem CID 117377922) has the molecular formula C13H12ClNO2
and a molecular weight of 249.70 g/mol. Its IUPAC name is 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile |
| PubChem CID | 117377922 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile |
| SMILES | N#CCc1cc2c(cc1Cl)OC1(CCCC1)O2 |
| InChI | InChI=1S/C13H12ClNO2/c14-10-8-12-11(7-9(10)3-6-15)16-13(17-12)4-1-2-5-13/h7-8H,1-5H2 |
| InChIKey | VJPYYZYBZOGNLO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile?
The IUPAC name of 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile (CID 117377922) is 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile.
What is the SMILES notation for 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile?
The canonical SMILES for 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile is N#CCc1cc2c(cc1Cl)OC1(CCCC1)O2.
What is the InChIKey of 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile?
The InChIKey is VJPYYZYBZOGNLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO2/c14-10-8-12-11(7-9(10)3-6-15)16-13(17-12)4-1-2-5-13/h7-8H,1-5H2.
What are the key properties of 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile?
2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile has a molecular weight of 249.70 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chlorospiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl)acetonitrile is sourced from PubChem (CID 117377922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).