C13H18F3NOSi — CID 11737817
2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]-N-(2-trimethylsilylethynyl)acetamide (PubChem CID 11737817) has the molecular formula C13H18F3NOSi and a molecular weight of 289.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]-N-(2-trimethylsilylethynyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]-N-(2-trimethylsilylethynyl)acetamide |
|---|---|
| PubChem CID | 11737817 |
| Molecular Formula | C13H18F3NOSi |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3E)-hexa-3,5-dienyl]-N-(2-trimethylsilylethynyl)acetamide |
| SMILES | C=C/C=C/CCN(C#C[Si](C)(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NOSi/c1-5-6-7-8-9-17(10-11-19(2,3)4)12(18)13(14,15)16/h5-7H,1,8-9H2,2-4H3/b7-6+ |
| InChIKey | BVAFOWGBGABZOT-VOTSOKGWSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|