3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid

C14H18O4 — CID 117379075

IUPAC3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid
SMILESCCc1cc2c(cc1CC(C)(C)C(=O)O)OCO2
InChIInChI=1S/C14H18O4/c1-4-9-5-11-12(18-8-17-11)6-10(9)7-14(2,3)13(15)16/h5-6H,4,7-8H2,1-3H3,(H,15,16)
InChIKeyFXBFOPCIUCRCAJ-UHFFFAOYSA-N
MW250.29 g/mol
LogP2.63
Rot. Bonds4

About 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid

3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid (PubChem CID 117379075) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid
PubChem CID117379075
Molecular FormulaC14H18O4
Molecular Weight250.29 g/mol
Exact Mass250.12
IUPAC Name3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid
SMILESCCc1cc2c(cc1CC(C)(C)C(=O)O)OCO2
InChIInChI=1S/C14H18O4/c1-4-9-5-11-12(18-8-17-11)6-10(9)7-14(2,3)13(15)16/h5-6H,4,7-8H2,1-3H3,(H,15,16)
InChIKeyFXBFOPCIUCRCAJ-UHFFFAOYSA-N
XLogP2.63
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid (CID 117379075) is 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid is CCc1cc2c(cc1CC(C)(C)C(=O)O)OCO2.
What is the InChIKey of 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid?
The InChIKey is FXBFOPCIUCRCAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-4-9-5-11-12(18-8-17-11)6-10(9)7-14(2,3)13(15)16/h5-6H,4,7-8H2,1-3H3,(H,15,16).
What are the key properties of 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid?
3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid has a molecular weight of 250.29 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-ethyl-1,3-benzodioxol-5-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 117379075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).