C14H22N2O2 — CID 117379674
1-[2-(2-piperazin-1-ylethyl)phenyl]ethane-1,2-diol (PubChem CID 117379674) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[2-(2-piperazin-1-ylethyl)phenyl]ethane-1,2-diol.
| Compound Name | 1-[2-(2-piperazin-1-ylethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 117379674 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[2-(2-piperazin-1-ylethyl)phenyl]ethane-1,2-diol |
| SMILES | OCC(O)c1ccccc1CCN1CCNCC1 |
| InChI | InChI=1S/C14H22N2O2/c17-11-14(18)13-4-2-1-3-12(13)5-8-16-9-6-15-7-10-16/h1-4,14-15,17-18H,5-11H2 |
| InChIKey | UEDAWHXMHRFFHV-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |