C13H18N2OS — CID 117379784
1-(2-tert-butyl-1,3-benzothiazol-5-yl)-N-methoxymethanamine (PubChem CID 117379784) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-benzothiazol-5-yl)-N-methoxymethanamine.
| Compound Name | 1-(2-tert-butyl-1,3-benzothiazol-5-yl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117379784 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(2-tert-butyl-1,3-benzothiazol-5-yl)-N-methoxymethanamine |
| SMILES | CONCc1ccc2sc(C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C13H18N2OS/c1-13(2,3)12-15-10-7-9(8-14-16-4)5-6-11(10)17-12/h5-7,14H,8H2,1-4H3 |
| InChIKey | BYVXWIAIVJGENP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|