About (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide
(E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide (PubChem CID 11738002) has the molecular formula C19H21NO2
and a molecular weight of 295.38 g/mol. Its IUPAC name is (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide |
| PubChem CID | 11738002 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide |
| SMILES | C[C@@H]([C@@H](O)c1ccccc1)N(C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H21NO2/c1-15(19(22)17-11-7-4-8-12-17)20(2)18(21)14-13-16-9-5-3-6-10-16/h3-15,19,22H,1-2H3/b14-13+/t15-,19+/m0/s1 |
| InChIKey | HFCKTKLUJNVURS-UHTSDLRISA-N |
| XLogP | 3.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide?
The IUPAC name of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide (CID 11738002) is (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide.
What is the SMILES notation for (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide?
The canonical SMILES for (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide is C[C@@H]([C@@H](O)c1ccccc1)N(C)C(=O)/C=C/c1ccccc1.
What is the InChIKey of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide?
The InChIKey is HFCKTKLUJNVURS-UHTSDLRISA-N. The full InChI is InChI=1S/C19H21NO2/c1-15(19(22)17-11-7-4-8-12-17)20(2)18(21)14-13-16-9-5-3-6-10-16/h3-15,19,22H,1-2H3/b14-13+/t15-,19+/m0/s1.
What are the key properties of (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide?
(E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide has a molecular weight of 295.38 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-N-methyl-3-phenylprop-2-enamide is sourced from PubChem (CID 11738002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).