About 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran
4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran (PubChem CID 11738007) has the molecular formula C15H21O4P
and a molecular weight of 296.30 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran |
| PubChem CID | 11738007 |
| Molecular Formula | C15H21O4P |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran |
| SMILES | CCOP(=O)(Cc1cc(C)cc2oc(C)cc12)OCC |
| InChI | InChI=1S/C15H21O4P/c1-5-17-20(16,18-6-2)10-13-7-11(3)8-15-14(13)9-12(4)19-15/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | ICFHAHIUUKASEG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran?
The IUPAC name of 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran (CID 11738007) is 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran.
What is the SMILES notation for 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran?
The canonical SMILES for 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran is CCOP(=O)(Cc1cc(C)cc2oc(C)cc12)OCC.
What is the InChIKey of 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran?
The InChIKey is ICFHAHIUUKASEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21O4P/c1-5-17-20(16,18-6-2)10-13-7-11(3)8-15-14(13)9-12(4)19-15/h7-9H,5-6,10H2,1-4H3.
What are the key properties of 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran?
4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran has a molecular weight of 296.30 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxyphosphorylmethyl)-2,6-dimethyl-1-benzofuran is sourced from PubChem (CID 11738007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).