C11H10FN3O3 — CID 117380458
5-(5-amino-1-methylpyrazol-4-yl)-3-fluoro-2-hydroxybenzoic acid (PubChem CID 117380458) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 5-(5-amino-1-methylpyrazol-4-yl)-3-fluoro-2-hydroxybenzoic acid.
| Compound Name | 5-(5-amino-1-methylpyrazol-4-yl)-3-fluoro-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 117380458 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-(5-amino-1-methylpyrazol-4-yl)-3-fluoro-2-hydroxybenzoic acid |
| SMILES | Cn1ncc(-c2cc(F)c(O)c(C(=O)O)c2)c1N |
| InChI | InChI=1S/C11H10FN3O3/c1-15-10(13)7(4-14-15)5-2-6(11(17)18)9(16)8(12)3-5/h2-4,16H,13H2,1H3,(H,17,18) |
| InChIKey | SLDGSLBJSKJDHP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |