C16H17NO5 — CID 11738205
(2S)-3-(5-nitro-2-phenylmethoxyphenyl)propane-1,2-diol (PubChem CID 11738205) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is (2S)-3-(5-nitro-2-phenylmethoxyphenyl)propane-1,2-diol.
| Compound Name | (2S)-3-(5-nitro-2-phenylmethoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 11738205 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2S)-3-(5-nitro-2-phenylmethoxyphenyl)propane-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccccc2)c(C[C@H](O)CO)c1 |
| InChI | InChI=1S/C16H17NO5/c18-10-15(19)9-13-8-14(17(20)21)6-7-16(13)22-11-12-4-2-1-3-5-12/h1-8,15,18-19H,9-11H2/t15-/m0/s1 |
| InChIKey | VGSFAINKNOKYIX-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|