C8H16O8S2 — CID 11738247
[(2R,3R)-4-[(3S,4S)-3,4-dihydroxythiolan-1-ium-1-yl]-1,3-dihydroxybutan-2-yl] sulfate (PubChem CID 11738247) has the molecular formula C8H16O8S2 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(2R,3R)-4-[(3S,4S)-3,4-dihydroxythiolan-1-ium-1-yl]-1,3-dihydroxybutan-2-yl] sulfate.
| Compound Name | [(2R,3R)-4-[(3S,4S)-3,4-dihydroxythiolan-1-ium-1-yl]-1,3-dihydroxybutan-2-yl] sulfate |
|---|---|
| PubChem CID | 11738247 |
| Molecular Formula | C8H16O8S2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [(2R,3R)-4-[(3S,4S)-3,4-dihydroxythiolan-1-ium-1-yl]-1,3-dihydroxybutan-2-yl] sulfate |
| SMILES | O=S(=O)([O-])O[C@H](CO)[C@@H](O)C[S+]1C[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C8H16O8S2/c9-1-8(16-18(13,14)15)7(12)4-17-2-5(10)6(11)3-17/h5-12H,1-4H2/t5-,6-,7+,8-/m1/s1 |
| InChIKey | IQPGVEXYASQTIO-OOJXKGFFSA-N |
| XLogP | -3.46 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|