C15H22ClN — CID 117382961
[1-(6-chloro-2,3-dimethylphenyl)cyclohexyl]methanamine (PubChem CID 117382961) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is [1-(6-chloro-2,3-dimethylphenyl)cyclohexyl]methanamine.
| Compound Name | [1-(6-chloro-2,3-dimethylphenyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 117382961 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | [1-(6-chloro-2,3-dimethylphenyl)cyclohexyl]methanamine |
| SMILES | Cc1ccc(Cl)c(C2(CN)CCCCC2)c1C |
| InChI | InChI=1S/C15H22ClN/c1-11-6-7-13(16)14(12(11)2)15(10-17)8-4-3-5-9-15/h6-7H,3-5,8-10,17H2,1-2H3 |
| InChIKey | ABCKLCAHQCACRJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |