About 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine
5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine (PubChem CID 117383170) has the molecular formula C11H9FN2O4
and a molecular weight of 252.20 g/mol. Its IUPAC name is 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine |
| PubChem CID | 117383170 |
| Molecular Formula | C11H9FN2O4 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine |
| SMILES | COc1c(F)cc2c(c1-c1cc(N)no1)OCO2 |
| InChI | InChI=1S/C11H9FN2O4/c1-15-10-5(12)2-7-11(17-4-16-7)9(10)6-3-8(13)14-18-6/h2-3H,4H2,1H3,(H2,13,14) |
| InChIKey | XQPVBEKQRPBOMY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine?
The IUPAC name of 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine (CID 117383170) is 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine?
The canonical SMILES for 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine is COc1c(F)cc2c(c1-c1cc(N)no1)OCO2.
What is the InChIKey of 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine?
The InChIKey is XQPVBEKQRPBOMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O4/c1-15-10-5(12)2-7-11(17-4-16-7)9(10)6-3-8(13)14-18-6/h2-3H,4H2,1H3,(H2,13,14).
What are the key properties of 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine?
5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine has a molecular weight of 252.20 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)-1,2-oxazol-3-amine is sourced from PubChem (CID 117383170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).