About 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid
3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid (PubChem CID 117383598) has the molecular formula C13H16O5
and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid.
Analyze 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid (CID 117383598) is 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid is COc1ccc2c(c1CC(C)C(=O)O)COCO2.
What is the InChIKey of 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid?
The InChIKey is UODOCLWYJFJFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O5/c1-8(13(14)15)5-9-10-6-17-7-18-12(10)4-3-11(9)16-2/h3-4,8H,5-7H2,1-2H3,(H,14,15).
What are the key properties of 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid?
3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid has a molecular weight of 252.27 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-methoxy-4H-1,3-benzodioxin-5-yl)-2-methylpropanoic acid is sourced from PubChem (CID 117383598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).