About 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one
2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one (PubChem CID 11738522) has the molecular formula C17H16ClN3O
and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one.
Molecular Properties
| Compound Name | 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one |
| PubChem CID | 11738522 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one |
| SMILES | CN1C(=O)C(C)(c2cccc(-c3cccc(Cl)c3)c2)N=C1N |
| InChI | InChI=1S/C17H16ClN3O/c1-17(15(22)21(2)16(19)20-17)13-7-3-5-11(9-13)12-6-4-8-14(18)10-12/h3-10H,1-2H3,(H2,19,20) |
| InChIKey | NOHPEKSBDPSXOM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one?
The IUPAC name of 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one (CID 11738522) is 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one.
What is the SMILES notation for 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one?
The canonical SMILES for 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one is CN1C(=O)C(C)(c2cccc(-c3cccc(Cl)c3)c2)N=C1N.
What is the InChIKey of 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one?
The InChIKey is NOHPEKSBDPSXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O/c1-17(15(22)21(2)16(19)20-17)13-7-3-5-11(9-13)12-6-4-8-14(18)10-12/h3-10H,1-2H3,(H2,19,20).
What are the key properties of 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one?
2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one has a molecular weight of 313.79 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[3-(3-chlorophenyl)phenyl]-3,5-dimethylimidazol-4-one is sourced from PubChem (CID 11738522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).