C19H38O3 — CID 11738551
1,15-dihydroxy-2,2,14,14-tetramethylpentadecan-8-one (PubChem CID 11738551) has the molecular formula C19H38O3 and a molecular weight of 314.51 g/mol. Its IUPAC name is 1,15-dihydroxy-2,2,14,14-tetramethylpentadecan-8-one.
| Compound Name | 1,15-dihydroxy-2,2,14,14-tetramethylpentadecan-8-one |
|---|---|
| PubChem CID | 11738551 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 1,15-dihydroxy-2,2,14,14-tetramethylpentadecan-8-one |
| SMILES | CC(C)(CO)CCCCCC(=O)CCCCCC(C)(C)CO |
| InChI | InChI=1S/C19H38O3/c1-18(2,15-20)13-9-5-7-11-17(22)12-8-6-10-14-19(3,4)16-21/h20-21H,5-16H2,1-4H3 |
| InChIKey | DUKRINNOEOZESB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|