C18H38O2Si — CID 11738553
(3R,7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-1-en-3-ol (PubChem CID 11738553) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is (3R,7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-1-en-3-ol.
| Compound Name | (3R,7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-1-en-3-ol |
|---|---|
| PubChem CID | 11738553 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (3R,7S)-7-methyl-8-tri(propan-2-yl)silyloxyoct-1-en-3-ol |
| SMILES | C=C[C@H](O)CCC[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H38O2Si/c1-9-18(19)12-10-11-17(8)13-20-21(14(2)3,15(4)5)16(6)7/h9,14-19H,1,10-13H2,2-8H3/t17-,18-/m0/s1 |
| InChIKey | AEMJNYISOIRWIM-ROUUACIJSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|