C13H19NS2 — CID 117386847
3-[3,4-bis(methylsulfanyl)phenyl]piperidine (PubChem CID 117386847) has the molecular formula C13H19NS2 and a molecular weight of 253.44 g/mol. Its IUPAC name is 3-[3,4-bis(methylsulfanyl)phenyl]piperidine.
| Compound Name | 3-[3,4-bis(methylsulfanyl)phenyl]piperidine |
|---|---|
| PubChem CID | 117386847 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-[3,4-bis(methylsulfanyl)phenyl]piperidine |
| SMILES | CSc1ccc(C2CCCNC2)cc1SC |
| InChI | InChI=1S/C13H19NS2/c1-15-12-6-5-10(8-13(12)16-2)11-4-3-7-14-9-11/h5-6,8,11,14H,3-4,7,9H2,1-2H3 |
| InChIKey | GXPWIOITADBCEW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |