C19H22N4O — CID 11738789
(2S)-1-[2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 11738789) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is (2S)-1-[2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 11738789 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2S)-1-[2-[[(3R)-2,3,4,9-tetrahydro-1H-carbazol-3-yl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CN[C@@H]1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C19H22N4O/c20-11-14-4-3-9-23(14)19(24)12-21-13-7-8-18-16(10-13)15-5-1-2-6-17(15)22-18/h1-2,5-6,13-14,21-22H,3-4,7-10,12H2/t13-,14+/m1/s1 |
| InChIKey | JGABNPBFMCLXNH-KGLIPLIRSA-N |
| XLogP | 2.13 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|