C20H24N2O2 — CID 11738843
(9S,10S,12S,13E,17S,18R)-13-ethylidene-17-(hydroxymethyl)-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-ol (PubChem CID 11738843) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (9S,10S,12S,13E,17S,18R)-13-ethylidene-17-(hydroxymethyl)-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-ol.
| Compound Name | (9S,10S,12S,13E,17S,18R)-13-ethylidene-17-(hydroxymethyl)-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-ol |
|---|---|
| PubChem CID | 11738843 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (9S,10S,12S,13E,17S,18R)-13-ethylidene-17-(hydroxymethyl)-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-ol |
| SMILES | C/C=C1/CN2C3CC45c6ccccc6N[C@@H]4[C@@H]2C[C@@H]1[C@]3(CO)[C@@H]5O |
| InChI | InChI=1S/C20H24N2O2/c1-2-11-9-22-15-7-13(11)20(10-23)16(22)8-19(18(20)24)12-5-3-4-6-14(12)21-17(15)19/h2-6,13,15-18,21,23-24H,7-10H2,1H3/b11-2-/t13-,15-,16?,17+,18+,19?,20-/m0/s1 |
| InChIKey | HFDJUZFVVFQYAX-IWLMKJTDSA-N |
| XLogP | 1.49 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|