C16H24NO4P — CID 11738863
(3R,5S,7aS)-5-diethoxyphosphoryl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole (PubChem CID 11738863) has the molecular formula C16H24NO4P and a molecular weight of 325.35 g/mol. Its IUPAC name is (3R,5S,7aS)-5-diethoxyphosphoryl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole.
| Compound Name | (3R,5S,7aS)-5-diethoxyphosphoryl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 11738863 |
| Molecular Formula | C16H24NO4P |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (3R,5S,7aS)-5-diethoxyphosphoryl-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazole |
| SMILES | CCOP(=O)(OCC)[C@H]1CC[C@@H]2OC[C@@H](c3ccccc3)N21 |
| InChI | InChI=1S/C16H24NO4P/c1-3-20-22(18,21-4-2)16-11-10-15-17(16)14(12-19-15)13-8-6-5-7-9-13/h5-9,14-16H,3-4,10-12H2,1-2H3/t14-,15-,16-/m0/s1 |
| InChIKey | XFGGLUZUTKWLKG-JYJNAYRXSA-N |
| XLogP | 3.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|