C19H23N3O2 — CID 11738878
methyl (8S,10S,14R)-13-iminospiro[1,11-diazatetracyclo[6.5.1.02,7.011,14]tetradeca-2,4,6-triene-12,1'-cyclohexane]-10-carboxylate (PubChem CID 11738878) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is methyl (8S,10S,14R)-13-iminospiro[1,11-diazatetracyclo[6.5.1.02,7.011,14]tetradeca-2,4,6-triene-12,1'-cyclohexane]-10-carboxylate.
| Compound Name | methyl (8S,10S,14R)-13-iminospiro[1,11-diazatetracyclo[6.5.1.02,7.011,14]tetradeca-2,4,6-triene-12,1'-cyclohexane]-10-carboxylate |
|---|---|
| PubChem CID | 11738878 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | methyl (8S,10S,14R)-13-iminospiro[1,11-diazatetracyclo[6.5.1.02,7.011,14]tetradeca-2,4,6-triene-12,1'-cyclohexane]-10-carboxylate |
| SMILES | [H]/N=C1\N2c3ccccc3[C@@H]3C[C@@H](C(=O)OC)N([C@@H]32)C12CCCCC2 |
| InChI | InChI=1S/C19H23N3O2/c1-24-17(23)15-11-13-12-7-3-4-8-14(12)21-16(13)22(15)19(18(21)20)9-5-2-6-10-19/h3-4,7-8,13,15-16,20H,2,5-6,9-11H2,1H3/b20-18-/t13-,15-,16-/m0/s1 |
| InChIKey | DNHPIZQAVYIJAI-XXRVCDDISA-N |
| XLogP | 2.86 |
| TPSA | 56.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|