C16H18N2O — CID 117389342
3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)propanal (PubChem CID 117389342) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)propanal.
| Compound Name | 3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)propanal |
|---|---|
| PubChem CID | 117389342 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-5-yl)propanal |
| SMILES | O=CCCc1ccc2[nH]c3c(c2c1)C1CCN3CC1 |
| InChI | InChI=1S/C16H18N2O/c19-9-1-2-11-3-4-14-13(10-11)15-12-5-7-18(8-6-12)16(15)17-14/h3-4,9-10,12,17H,1-2,5-8H2 |
| InChIKey | YLWFVFZCNRHJPA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|