C17H36O2Si2 — CID 11738958
(2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol (PubChem CID 11738958) has the molecular formula C17H36O2Si2 and a molecular weight of 328.65 g/mol. Its IUPAC name is (2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol.
| Compound Name | (2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 11738958 |
| Molecular Formula | C17H36O2Si2 |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (2R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-6-trimethylsilylhex-5-yn-3-ol |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H36O2Si2/c1-14(11-12-20(6,7)8)16(18)15(2)13-19-21(9,10)17(3,4)5/h14-16,18H,13H2,1-10H3/t14-,15+,16-/m0/s1 |
| InChIKey | NFTKOYRXDGRBSA-XHSDSOJGSA-N |
| XLogP | 4.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|