C15H14Cl2O4 — CID 11738963
1-O-ethyl 6-O-methyl (2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioate (PubChem CID 11738963) has the molecular formula C15H14Cl2O4 and a molecular weight of 329.18 g/mol. Its IUPAC name is 1-O-ethyl 6-O-methyl (2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioate.
| Compound Name | 1-O-ethyl 6-O-methyl (2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 11738963 |
| Molecular Formula | C15H14Cl2O4 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-O-ethyl 6-O-methyl (2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C(=C/C=C\C(=O)OC)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2O4/c1-3-21-15(19)11(5-4-6-14(18)20-2)10-7-8-12(16)13(17)9-10/h4-9H,3H2,1-2H3/b6-4-,11-5+ |
| InChIKey | RIFDFDLVVHPHEC-NQTKGXIKSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|