C11H21N2+ — CID 11739001
5-ethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium (PubChem CID 11739001) has the molecular formula C11H21N2+ and a molecular weight of 181.30 g/mol. Its IUPAC name is 5-ethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium.
| Compound Name | 5-ethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 11739001 |
| Molecular Formula | C11H21N2+ |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.17 |
| IUPAC Name | 5-ethyl-2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium |
| SMILES | CC[N+]12CCCCCC1=NCCC2 |
| InChI | InChI=1S/C11H21N2/c1-2-13-9-5-3-4-7-11(13)12-8-6-10-13/h2-10H2,1H3/q+1 |
| InChIKey | FBIVBEWZDWUECO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|