C11H13NO6 — CID 117390534
3-(2-amino-1-carboxyethyl)-4-hydroxy-5-methoxybenzoic acid (PubChem CID 117390534) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is 3-(2-amino-1-carboxyethyl)-4-hydroxy-5-methoxybenzoic acid.
| Compound Name | 3-(2-amino-1-carboxyethyl)-4-hydroxy-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 117390534 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(2-amino-1-carboxyethyl)-4-hydroxy-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(C(CN)C(=O)O)c1O |
| InChI | InChI=1S/C11H13NO6/c1-18-8-3-5(10(14)15)2-6(9(8)13)7(4-12)11(16)17/h2-3,7,13H,4,12H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | LXTODWZLYUCMFM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |