About 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine
5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine (PubChem CID 117390598) has the molecular formula C12H12F3N3
and a molecular weight of 255.24 g/mol. Its IUPAC name is 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine |
| PubChem CID | 117390598 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine |
| SMILES | CC(C)(F)c1cc(F)c(F)c(-c2cc(N)n[nH]2)c1 |
| InChI | InChI=1S/C12H12F3N3/c1-12(2,15)6-3-7(11(14)8(13)4-6)9-5-10(16)18-17-9/h3-5H,1-2H3,(H3,16,17,18) |
| InChIKey | ZWDYUQNZCAEQPW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine?
The IUPAC name of 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine (CID 117390598) is 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine.
What is the SMILES notation for 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine?
The canonical SMILES for 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine is CC(C)(F)c1cc(F)c(F)c(-c2cc(N)n[nH]2)c1.
What is the InChIKey of 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine?
The InChIKey is ZWDYUQNZCAEQPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3N3/c1-12(2,15)6-3-7(11(14)8(13)4-6)9-5-10(16)18-17-9/h3-5H,1-2H3,(H3,16,17,18).
What are the key properties of 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine?
5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine has a molecular weight of 255.24 g/mol, XLogP of 3.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,3-difluoro-5-(2-fluoropropan-2-yl)phenyl]-1H-pyrazol-3-amine is sourced from PubChem (CID 117390598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).