C12H12F3N3 — CID 117390611
1-methyl-4-[4-(2,2,2-trifluoroethyl)phenyl]pyrazol-5-amine (PubChem CID 117390611) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-methyl-4-[4-(2,2,2-trifluoroethyl)phenyl]pyrazol-5-amine.
| Compound Name | 1-methyl-4-[4-(2,2,2-trifluoroethyl)phenyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 117390611 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-methyl-4-[4-(2,2,2-trifluoroethyl)phenyl]pyrazol-5-amine |
| SMILES | Cn1ncc(-c2ccc(CC(F)(F)F)cc2)c1N |
| InChI | InChI=1S/C12H12F3N3/c1-18-11(16)10(7-17-18)9-4-2-8(3-5-9)6-12(13,14)15/h2-5,7H,6,16H2,1H3 |
| InChIKey | AKUMMWFHJDCWSB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |