C13H15F2NO2 — CID 117390767
4-(6,7-difluoro-2,3-dihydro-1,4-benzodioxin-5-yl)piperidine (PubChem CID 117390767) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 4-(6,7-difluoro-2,3-dihydro-1,4-benzodioxin-5-yl)piperidine.
| Compound Name | 4-(6,7-difluoro-2,3-dihydro-1,4-benzodioxin-5-yl)piperidine |
|---|---|
| PubChem CID | 117390767 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4-(6,7-difluoro-2,3-dihydro-1,4-benzodioxin-5-yl)piperidine |
| SMILES | Fc1cc2c(c(C3CCNCC3)c1F)OCCO2 |
| InChI | InChI=1S/C13H15F2NO2/c14-9-7-10-13(18-6-5-17-10)11(12(9)15)8-1-3-16-4-2-8/h7-8,16H,1-6H2 |
| InChIKey | PEIUMBYTAUPFLQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |