C16H21N3 — CID 117391793
3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)propan-1-amine (PubChem CID 117391793) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)propan-1-amine.
| Compound Name | 3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)propan-1-amine |
|---|---|
| PubChem CID | 117391793 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraen-7-yl)propan-1-amine |
| SMILES | NCCCc1cccc2c3c([nH]c12)N1CCC3CC1 |
| InChI | InChI=1S/C16H21N3/c17-8-2-4-12-3-1-5-13-14-11-6-9-19(10-7-11)16(14)18-15(12)13/h1,3,5,11,18H,2,4,6-10,17H2 |
| InChIKey | VSOQOTSPPUCGHD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |