C19H30O5 — CID 11739251
[(1S,3R,4R,4aS)-3-acetyloxy-4-formyl-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate (PubChem CID 11739251) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is [(1S,3R,4R,4aS)-3-acetyloxy-4-formyl-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [(1S,3R,4R,4aS)-3-acetyloxy-4-formyl-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 11739251 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [(1S,3R,4R,4aS)-3-acetyloxy-4-formyl-3,4a,8,8-tetramethyl-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@](C)(OC(C)=O)[C@H](C=O)[C@@]2(C)CCCC(C)(C)C12 |
| InChI | InChI=1S/C19H30O5/c1-12(21)23-14-10-19(6,24-13(2)22)15(11-20)18(5)9-7-8-17(3,4)16(14)18/h11,14-16H,7-10H2,1-6H3/t14-,15+,16?,18+,19+/m0/s1 |
| InChIKey | YHVUJLWLITZFDH-GKILCIEYSA-N |
| XLogP | 3.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|