About N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine
N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine (PubChem CID 11739284) has the molecular formula C20H22FN3O
and a molecular weight of 339.41 g/mol. Its IUPAC name is N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine |
| PubChem CID | 11739284 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCCCNc1nnc(C(C)c2ccc(-c3ccccc3)c(F)c2)o1 |
| InChI | InChI=1S/C20H22FN3O/c1-3-4-12-22-20-24-23-19(25-20)14(2)16-10-11-17(18(21)13-16)15-8-6-5-7-9-15/h5-11,13-14H,3-4,12H2,1-2H3,(H,22,24) |
| InChIKey | VDEPLMCXRPZNST-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine?
The IUPAC name of N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine (CID 11739284) is N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine?
The canonical SMILES for N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine is CCCCNc1nnc(C(C)c2ccc(-c3ccccc3)c(F)c2)o1.
What is the InChIKey of N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine?
The InChIKey is VDEPLMCXRPZNST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN3O/c1-3-4-12-22-20-24-23-19(25-20)14(2)16-10-11-17(18(21)13-16)15-8-6-5-7-9-15/h5-11,13-14H,3-4,12H2,1-2H3,(H,22,24).
What are the key properties of N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine?
N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine has a molecular weight of 339.41 g/mol, XLogP of 5.24, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 11739284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).