C13H18ClNS — CID 117393114
2-[(2-chloro-5-methylsulfanylphenyl)methyl]piperidine (PubChem CID 117393114) has the molecular formula C13H18ClNS and a molecular weight of 255.81 g/mol. Its IUPAC name is 2-[(2-chloro-5-methylsulfanylphenyl)methyl]piperidine.
| Compound Name | 2-[(2-chloro-5-methylsulfanylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 117393114 |
| Molecular Formula | C13H18ClNS |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[(2-chloro-5-methylsulfanylphenyl)methyl]piperidine |
| SMILES | CSc1ccc(Cl)c(CC2CCCCN2)c1 |
| InChI | InChI=1S/C13H18ClNS/c1-16-12-5-6-13(14)10(9-12)8-11-4-2-3-7-15-11/h5-6,9,11,15H,2-4,7-8H2,1H3 |
| InChIKey | AHFZNEXELIEJMY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |