C16H25ClN4O2 — CID 11739334
N-[4-[[amino-(4-methylpiperidine-1-carbonyl)amino]methyl]phenyl]acetamide;hydrochloride (PubChem CID 11739334) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is N-[4-[[amino-(4-methylpiperidine-1-carbonyl)amino]methyl]phenyl]acetamide;hydrochloride.
| Compound Name | N-[4-[[amino-(4-methylpiperidine-1-carbonyl)amino]methyl]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 11739334 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[4-[[amino-(4-methylpiperidine-1-carbonyl)amino]methyl]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(CN(N)C(=O)N2CCC(C)CC2)cc1.Cl |
| InChI | InChI=1S/C16H24N4O2.ClH/c1-12-7-9-19(10-8-12)16(22)20(17)11-14-3-5-15(6-4-14)18-13(2)21;/h3-6,12H,7-11,17H2,1-2H3,(H,18,21);1H |
| InChIKey | KCCYTGIMRKHTNP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|