About 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide
1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide (PubChem CID 11739397) has the molecular formula C18H19BrN2
and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide.
Molecular Properties
| Compound Name | 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide |
| PubChem CID | 11739397 |
| Molecular Formula | C18H19BrN2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide |
| SMILES | CC(C)N1CC[n+]2c1c1ccccc1c1ccccc12.[Br-] |
| InChI | InChI=1S/C18H19N2.BrH/c1-13(2)19-11-12-20-17-10-6-5-8-15(17)14-7-3-4-9-16(14)18(19)20;/h3-10,13H,11-12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KUVYVBISALEJFC-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
The IUPAC name of 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide (CID 11739397) is 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide.
What is the SMILES notation for 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
The canonical SMILES for 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide is CC(C)N1CC[n+]2c1c1ccccc1c1ccccc12.[Br-].
What is the InChIKey of 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
The InChIKey is KUVYVBISALEJFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H19N2.BrH/c1-13(2)19-11-12-20-17-10-6-5-8-15(17)14-7-3-4-9-16(14)18(19)20;/h3-10,13H,11-12H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide?
1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide has a molecular weight of 343.27 g/mol, XLogP of 0.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-2,3-dihydroimidazo[1,2-f]phenanthridin-4-ium bromide is sourced from PubChem (CID 11739397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).