About 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol
2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol (PubChem CID 117394666) has the molecular formula C13H20O3S
and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol |
| PubChem CID | 117394666 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol |
| SMILES | Cc1cc(S(C)(=O)=O)cc(C(C)(C)CO)c1C |
| InChI | InChI=1S/C13H20O3S/c1-9-6-11(17(5,15)16)7-12(10(9)2)13(3,4)8-14/h6-7,14H,8H2,1-5H3 |
| InChIKey | BIXXTGYSVREYLV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol?
The IUPAC name of 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol (CID 117394666) is 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol.
What is the SMILES notation for 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol?
The canonical SMILES for 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol is Cc1cc(S(C)(=O)=O)cc(C(C)(C)CO)c1C.
What is the InChIKey of 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol?
The InChIKey is BIXXTGYSVREYLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3S/c1-9-6-11(17(5,15)16)7-12(10(9)2)13(3,4)8-14/h6-7,14H,8H2,1-5H3.
What are the key properties of 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol?
2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol has a molecular weight of 256.37 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethyl-5-methylsulfonylphenyl)-2-methylpropan-1-ol is sourced from PubChem (CID 117394666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).