About 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine
5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine (PubChem CID 117394730) has the molecular formula C10H6ClFN2O3
and a molecular weight of 256.62 g/mol. Its IUPAC name is 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
| PubChem CID | 117394730 |
| Molecular Formula | C10H6ClFN2O3 |
| Molecular Weight | 256.62 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine |
| SMILES | Nc1cc(-c2cc3c(c(Cl)c2F)OCO3)on1 |
| InChI | InChI=1S/C10H6ClFN2O3/c11-8-9(12)4(5-2-7(13)14-17-5)1-6-10(8)16-3-15-6/h1-2H,3H2,(H2,13,14) |
| InChIKey | CIPVAXLVBLREBT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine?
The IUPAC name of 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine (CID 117394730) is 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine.
What is the SMILES notation for 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine?
The canonical SMILES for 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine is Nc1cc(-c2cc3c(c(Cl)c2F)OCO3)on1.
What is the InChIKey of 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine?
The InChIKey is CIPVAXLVBLREBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClFN2O3/c11-8-9(12)4(5-2-7(13)14-17-5)1-6-10(8)16-3-15-6/h1-2H,3H2,(H2,13,14).
What are the key properties of 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine?
5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine has a molecular weight of 256.62 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(7-chloro-6-fluoro-1,3-benzodioxol-5-yl)-1,2-oxazol-3-amine is sourced from PubChem (CID 117394730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).