About N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine
N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine (PubChem CID 11739521) has the molecular formula C14H14BrN5O
and a molecular weight of 348.20 g/mol. Its IUPAC name is N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine |
| PubChem CID | 11739521 |
| Molecular Formula | C14H14BrN5O |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine |
| SMILES | CC(C)(C)c1conc1Nc1ncnc2cc(Br)cnc12 |
| InChI | InChI=1S/C14H14BrN5O/c1-14(2,3)9-6-21-20-12(9)19-13-11-10(17-7-18-13)4-8(15)5-16-11/h4-7H,1-3H3,(H,17,18,19,20) |
| InChIKey | WPDPAZXADPGWEJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine?
The IUPAC name of N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine (CID 11739521) is N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine.
What is the SMILES notation for N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine?
The canonical SMILES for N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine is CC(C)(C)c1conc1Nc1ncnc2cc(Br)cnc12.
What is the InChIKey of N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine?
The InChIKey is WPDPAZXADPGWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN5O/c1-14(2,3)9-6-21-20-12(9)19-13-11-10(17-7-18-13)4-8(15)5-16-11/h4-7H,1-3H3,(H,17,18,19,20).
What are the key properties of N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine?
N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine has a molecular weight of 348.20 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-bromopyrido[3,2-d]pyrimidin-4-yl)-4-tert-butyl-1,2-oxazol-3-amine is sourced from PubChem (CID 11739521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).