C19H24O4S — CID 11739536
(3S,4R,5R)-3-(benzenesulfonyl)-3,4-bis(prop-2-enyl)-5-propyloxolan-2-one (PubChem CID 11739536) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is (3S,4R,5R)-3-(benzenesulfonyl)-3,4-bis(prop-2-enyl)-5-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(benzenesulfonyl)-3,4-bis(prop-2-enyl)-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 11739536 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (3S,4R,5R)-3-(benzenesulfonyl)-3,4-bis(prop-2-enyl)-5-propyloxolan-2-one |
| SMILES | C=CC[C@@H]1[C@@H](CCC)OC(=O)[C@@]1(CC=C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24O4S/c1-4-10-16-17(11-5-2)23-18(20)19(16,14-6-3)24(21,22)15-12-8-7-9-13-15/h4,6-9,12-13,16-17H,1,3,5,10-11,14H2,2H3/t16-,17-,19+/m1/s1 |
| InChIKey | KNRAYPUVJPKGTH-LMMKCTJWSA-N |
| XLogP | 3.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|