C20H32O3Si — CID 11739545
(4aR,5S,8aS)-5-methyl-6-tri(propan-2-yl)silyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione (PubChem CID 11739545) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is (4aR,5S,8aS)-5-methyl-6-tri(propan-2-yl)silyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione.
| Compound Name | (4aR,5S,8aS)-5-methyl-6-tri(propan-2-yl)silyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11739545 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (4aR,5S,8aS)-5-methyl-6-tri(propan-2-yl)silyloxy-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
| SMILES | CC(C)[Si](OC1=CC[C@@H]2C(=O)C=CC(=O)[C@@H]2[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H32O3Si/c1-12(2)24(13(3)4,14(5)6)23-19-11-8-16-17(21)9-10-18(22)20(16)15(19)7/h9-16,20H,8H2,1-7H3/t15-,16-,20-/m1/s1 |
| InChIKey | YDZUKFWTQRUWSL-JXXFODFXSA-N |
| XLogP | 5.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|