C15H16ClN4O2P — CID 11739606
6-(4-chlorophenyl)-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide (PubChem CID 11739606) has the molecular formula C15H16ClN4O2P and a molecular weight of 350.75 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide.
| Compound Name | 6-(4-chlorophenyl)-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide |
|---|---|
| PubChem CID | 11739606 |
| Molecular Formula | C15H16ClN4O2P |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 6-(4-chlorophenyl)-2,4-dimethyl-3-phenoxy-1H-1,2,4,5,3λ5-tetrazaphosphinine 3-oxide |
| SMILES | CN1N=C(c2ccc(Cl)cc2)NN(C)P1(=O)Oc1ccccc1 |
| InChI | InChI=1S/C15H16ClN4O2P/c1-19-17-15(12-8-10-13(16)11-9-12)18-20(2)23(19,21)22-14-6-4-3-5-7-14/h3-11H,1-2H3,(H,17,18) |
| InChIKey | QGNILABJOQLPQH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|