C13H17F2NO2 — CID 117396171
2-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]pyrrolidine (PubChem CID 117396171) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is 2-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]pyrrolidine.
| Compound Name | 2-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 117396171 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]pyrrolidine |
| SMILES | COc1cc(OC)c(F)c(CC2CCCN2)c1F |
| InChI | InChI=1S/C13H17F2NO2/c1-17-10-7-11(18-2)13(15)9(12(10)14)6-8-4-3-5-16-8/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | VREXNXBKDQRCMJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |