C21H20O5 — CID 11739634
(1R,12R)-17-(3-methylbut-2-enyl)-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol (PubChem CID 11739634) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (1R,12R)-17-(3-methylbut-2-enyl)-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol.
| Compound Name | (1R,12R)-17-(3-methylbut-2-enyl)-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol |
|---|---|
| PubChem CID | 11739634 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (1R,12R)-17-(3-methylbut-2-enyl)-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol |
| SMILES | CC(C)=CCc1c(O)ccc2c1OC[C@H]1c3cc4c(cc3O[C@@H]21)OCO4 |
| InChI | InChI=1S/C21H20O5/c1-11(2)3-4-12-16(22)6-5-13-20(12)23-9-15-14-7-18-19(25-10-24-18)8-17(14)26-21(13)15/h3,5-8,15,21-22H,4,9-10H2,1-2H3/t15-,21-/m0/s1 |
| InChIKey | QUNOVMVJDFPSOE-BTYIYWSLSA-N |
| XLogP | 4.24 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|