C18H18Cl2O3 — CID 11739662
(2E,4E)-5-(7,8-dichloro-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 11739662) has the molecular formula C18H18Cl2O3 and a molecular weight of 353.25 g/mol. Its IUPAC name is (2E,4E)-5-(7,8-dichloro-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(7,8-dichloro-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 11739662 |
| Molecular Formula | C18H18Cl2O3 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (2E,4E)-5-(7,8-dichloro-3,3-dimethyl-2H-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/C1=CC(C)(C)COc2cc(Cl)c(Cl)cc21)=C\C(=O)O |
| InChI | InChI=1S/C18H18Cl2O3/c1-11(6-17(21)22)4-5-12-9-18(2,3)10-23-16-8-15(20)14(19)7-13(12)16/h4-9H,10H2,1-3H3,(H,21,22)/b5-4+,11-6+ |
| InChIKey | UDETXIDFZNYGNM-LJIKRCSCSA-N |
| XLogP | 5.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|