C20H23N3O3 — CID 11739678
6-(cyclohexylamino)-1,3-dimethyl-5-phenylfuro[2,3-d]pyrimidine-2,4-dione (PubChem CID 11739678) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 6-(cyclohexylamino)-1,3-dimethyl-5-phenylfuro[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(cyclohexylamino)-1,3-dimethyl-5-phenylfuro[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11739678 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 6-(cyclohexylamino)-1,3-dimethyl-5-phenylfuro[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)c(NC3CCCCC3)oc2n(C)c1=O |
| InChI | InChI=1S/C20H23N3O3/c1-22-18(24)16-15(13-9-5-3-6-10-13)17(21-14-11-7-4-8-12-14)26-19(16)23(2)20(22)25/h3,5-6,9-10,14,21H,4,7-8,11-12H2,1-2H3 |
| InChIKey | XOMBMGAPVMZEDB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |