C19H19N3O2S — CID 11739679
4-[3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline (PubChem CID 11739679) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 4-[3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline.
| Compound Name | 4-[3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 11739679 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 4-[3-(1,2,3,6-tetrahydropyridin-4-yl)indol-1-yl]sulfonylaniline |
| SMILES | Nc1ccc(S(=O)(=O)n2cc(C3=CCNCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c20-15-5-7-16(8-6-15)25(23,24)22-13-18(14-9-11-21-12-10-14)17-3-1-2-4-19(17)22/h1-9,13,21H,10-12,20H2 |
| InChIKey | VGOOFUGEHCADCQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|