About 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol
7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol (PubChem CID 11739707) has the molecular formula C24H18O3
and a molecular weight of 354.41 g/mol. Its IUPAC name is 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol.
Molecular Properties
| Compound Name | 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol |
| PubChem CID | 11739707 |
| Molecular Formula | C24H18O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol |
| SMILES | Cc1cccc(-c2c3c(cc4ccc(O)cc24)-c2ccc(O)cc2CO3)c1 |
| InChI | InChI=1S/C24H18O3/c1-14-3-2-4-16(9-14)23-21-12-19(26)6-5-15(21)11-22-20-8-7-18(25)10-17(20)13-27-24(22)23/h2-12,25-26H,13H2,1H3 |
| InChIKey | ATGRADSMEWCSRF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol?
The IUPAC name of 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol (CID 11739707) is 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol.
What is the SMILES notation for 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol?
The canonical SMILES for 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol is Cc1cccc(-c2c3c(cc4ccc(O)cc24)-c2ccc(O)cc2CO3)c1.
What is the InChIKey of 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol?
The InChIKey is ATGRADSMEWCSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18O3/c1-14-3-2-4-16(9-14)23-21-12-19(26)6-5-15(21)11-22-20-8-7-18(25)10-17(20)13-27-24(22)23/h2-12,25-26H,13H2,1H3.
What are the key properties of 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol?
7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol has a molecular weight of 354.41 g/mol, XLogP of 5.79, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-methylphenyl)-5H-naphtho[3,2-c]isochromene-3,9-diol is sourced from PubChem (CID 11739707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).