C16H23N3 — CID 117397204
[5-(2,3-dimethyl-1H-indol-7-yl)-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 117397204) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is [5-(2,3-dimethyl-1H-indol-7-yl)-1-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [5-(2,3-dimethyl-1H-indol-7-yl)-1-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 117397204 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | [5-(2,3-dimethyl-1H-indol-7-yl)-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | Cc1[nH]c2c(C3CC(CN)CN3C)cccc2c1C |
| InChI | InChI=1S/C16H23N3/c1-10-11(2)18-16-13(10)5-4-6-14(16)15-7-12(8-17)9-19(15)3/h4-6,12,15,18H,7-9,17H2,1-3H3 |
| InChIKey | IBALQNBDYMYLOA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|