C16H16N4O3S2 — CID 1173981
N-[4-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]methanesulfonamide (PubChem CID 1173981) has the molecular formula C16H16N4O3S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 1173981 |
| Molecular Formula | C16H16N4O3S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]phenyl]methanesulfonamide |
| SMILES | COc1ccccc1-n1c(-c2ccc(NS(C)(=O)=O)cc2)n[nH]c1=S |
| InChI | InChI=1S/C16H16N4O3S2/c1-23-14-6-4-3-5-13(14)20-15(17-18-16(20)24)11-7-9-12(10-8-11)19-25(2,21)22/h3-10,19H,1-2H3,(H,18,24) |
| InChIKey | UOLAIOKRGJJZRI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|