C10H12BrNO2 — CID 117398380
3-[(1-aminocyclopropyl)methyl]-6-bromobenzene-1,2-diol (PubChem CID 117398380) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is 3-[(1-aminocyclopropyl)methyl]-6-bromobenzene-1,2-diol.
| Compound Name | 3-[(1-aminocyclopropyl)methyl]-6-bromobenzene-1,2-diol |
|---|---|
| PubChem CID | 117398380 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-[(1-aminocyclopropyl)methyl]-6-bromobenzene-1,2-diol |
| SMILES | NC1(Cc2ccc(Br)c(O)c2O)CC1 |
| InChI | InChI=1S/C10H12BrNO2/c11-7-2-1-6(8(13)9(7)14)5-10(12)3-4-10/h1-2,13-14H,3-5,12H2 |
| InChIKey | HWBKOQXVJYOEAJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|